About 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide
2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide (PubChem CID 112712306) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide |
| PubChem CID | 112712306 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(N2CCCC2)o1 |
| InChI | InChI=1S/C8H12N4O/c9-7(10)6-5-11-8(13-6)12-3-1-2-4-12/h5H,1-4H2,(H3,9,10) |
| InChIKey | SSESDHWUMCEHRO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide?
The IUPAC name of 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide (CID 112712306) is 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide.
What is the SMILES notation for 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide?
The canonical SMILES for 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide is [H]/N=C(\N)c1cnc(N2CCCC2)o1.
What is the InChIKey of 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide?
The InChIKey is SSESDHWUMCEHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c9-7(10)6-5-11-8(13-6)12-3-1-2-4-12/h5H,1-4H2,(H3,9,10).
What are the key properties of 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide?
2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide has a molecular weight of 180.21 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-yl-1,3-oxazole-5-carboximidamide is sourced from PubChem (CID 112712306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).