About (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol
(5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol (PubChem CID 112712355) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol.
Molecular Properties
| Compound Name | (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol |
| PubChem CID | 112712355 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol |
| SMILES | NC1=CC2C=C(CO)SC2C=C1 |
| InChI | InChI=1S/C9H11NOS/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-4,6,9,11H,5,10H2 |
| InChIKey | RIFGIQJZGXJMDL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol?
The IUPAC name of (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol (CID 112712355) is (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol.
What is the SMILES notation for (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol?
The canonical SMILES for (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol is NC1=CC2C=C(CO)SC2C=C1.
What is the InChIKey of (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol?
The InChIKey is RIFGIQJZGXJMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-4,6,9,11H,5,10H2.
What are the key properties of (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol?
(5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol has a molecular weight of 181.26 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-3a,7a-dihydro-1-benzothiophen-2-yl)methanol is sourced from PubChem (CID 112712355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).