C10H15N3O — CID 112712756
8-amino-6,6-dimethyl-1,5,7,8-tetrahydroquinazolin-2-one (PubChem CID 112712756) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 8-amino-6,6-dimethyl-1,5,7,8-tetrahydroquinazolin-2-one.
| Compound Name | 8-amino-6,6-dimethyl-1,5,7,8-tetrahydroquinazolin-2-one |
|---|---|
| PubChem CID | 112712756 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 8-amino-6,6-dimethyl-1,5,7,8-tetrahydroquinazolin-2-one |
| SMILES | CC1(C)Cc2cnc(=O)[nH]c2C(N)C1 |
| InChI | InChI=1S/C10H15N3O/c1-10(2)3-6-5-12-9(14)13-8(6)7(11)4-10/h5,7H,3-4,11H2,1-2H3,(H,12,13,14) |
| InChIKey | ZZTWSBDXCXSAFS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |