About 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone
1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone (PubChem CID 112712759) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone.
Molecular Properties
| Compound Name | 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone |
| PubChem CID | 112712759 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone |
| SMILES | NCC(=O)C1=CC2C=CSC2C=C1 |
| InChI | InChI=1S/C10H11NOS/c11-6-9(12)7-1-2-10-8(5-7)3-4-13-10/h1-5,8,10H,6,11H2 |
| InChIKey | UOKWQJGCRPYIGX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone?
The IUPAC name of 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone (CID 112712759) is 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone.
What is the SMILES notation for 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone?
The canonical SMILES for 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone is NCC(=O)C1=CC2C=CSC2C=C1.
What is the InChIKey of 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone?
The InChIKey is UOKWQJGCRPYIGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c11-6-9(12)7-1-2-10-8(5-7)3-4-13-10/h1-5,8,10H,6,11H2.
What are the key properties of 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone?
1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone has a molecular weight of 193.27 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3a,7a-dihydro-1-benzothiophen-5-yl)-2-aminoethanone is sourced from PubChem (CID 112712759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).