C26H30F2N4O2 — CID 11271320
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-1H-pyrazole-4-carboxamide (PubChem CID 11271320) has the molecular formula C26H30F2N4O2 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 11271320 |
| Molecular Formula | C26H30F2N4O2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-1H-pyrazole-4-carboxamide |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1cn[nH]c1)CCC2 |
| InChI | InChI=1S/C26H30F2N4O2/c1-2-16-6-7-18-4-3-5-23(22(18)10-16)29-15-25(33)24(32-26(34)19-13-30-31-14-19)11-17-8-20(27)12-21(28)9-17/h6-10,12-14,23-25,29,33H,2-5,11,15H2,1H3,(H,30,31)(H,32,34)/t23-,24-,25+/m0/s1 |
| InChIKey | TTXYDBOFBCWAQB-CCDWMCETSA-N |
| XLogP | 3.62 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |