About spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine
spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine (PubChem CID 112714224) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine.
Molecular Properties
| Compound Name | spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine |
| PubChem CID | 112714224 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine |
| SMILES | NCC1c2ccoc2CC12CC2 |
| InChI | InChI=1S/C10H13NO/c11-6-8-7-1-4-12-9(7)5-10(8)2-3-10/h1,4,8H,2-3,5-6,11H2 |
| InChIKey | FRETYIKTGXDFPF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine?
The IUPAC name of spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine (CID 112714224) is spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine.
What is the SMILES notation for spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine?
The canonical SMILES for spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine is NCC1c2ccoc2CC12CC2.
What is the InChIKey of spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine?
The InChIKey is FRETYIKTGXDFPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c11-6-8-7-1-4-12-9(7)5-10(8)2-3-10/h1,4,8H,2-3,5-6,11H2.
What are the key properties of spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine?
spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine has a molecular weight of 163.22 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4,6-dihydrocyclopenta[b]furan-5,1'-cyclopropane]-4-ylmethanamine is sourced from PubChem (CID 112714224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).