About 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene
3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene (PubChem CID 112714414) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene.
Analyze 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene?
The IUPAC name of 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene (CID 112714414) is 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene.
What is the SMILES notation for 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene?
The canonical SMILES for 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene is c1cc2c(cn1)CC1CCCNC21.
What is the InChIKey of 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene?
The InChIKey is WEWIFKFOAJFTAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-8-6-9-7-12-5-3-10(9)11(8)13-4-1/h3,5,7-8,11,13H,1-2,4,6H2.
What are the key properties of 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene?
3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene has a molecular weight of 174.25 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,11-diazatricyclo[7.4.0.02,7]trideca-1(9),10,12-triene is sourced from PubChem (CID 112714414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).