About spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one
spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one (PubChem CID 112714436) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one.
Molecular Properties
| Compound Name | spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one |
| PubChem CID | 112714436 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one |
| SMILES | O=C1c2cn[nH]c2CCC12CCC2 |
| InChI | InChI=1S/C10H12N2O/c13-9-7-6-11-12-8(7)2-5-10(9)3-1-4-10/h6H,1-5H2,(H,11,12) |
| InChIKey | NFRBZVSIFUIGBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one?
The IUPAC name of spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one (CID 112714436) is spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one.
What is the SMILES notation for spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one?
The canonical SMILES for spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one is O=C1c2cn[nH]c2CCC12CCC2.
What is the InChIKey of spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one?
The InChIKey is NFRBZVSIFUIGBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c13-9-7-6-11-12-8(7)2-5-10(9)3-1-4-10/h6H,1-5H2,(H,11,12).
What are the key properties of spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one?
spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one has a molecular weight of 176.22 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[6,7-dihydro-1H-indazole-5,1'-cyclobutane]-4-one is sourced from PubChem (CID 112714436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).