About N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine
N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine (PubChem CID 112714495) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine.
Molecular Properties
| Compound Name | N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine |
| PubChem CID | 112714495 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine |
| SMILES | CNC1c2cocc2CCC12CC2 |
| InChI | InChI=1S/C11H15NO/c1-12-10-9-7-13-6-8(9)2-3-11(10)4-5-11/h6-7,10,12H,2-5H2,1H3 |
| InChIKey | LSKXKKRXPZWVBE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine?
The IUPAC name of N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine (CID 112714495) is N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine.
What is the SMILES notation for N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine?
The canonical SMILES for N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine is CNC1c2cocc2CCC12CC2.
What is the InChIKey of N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine?
The InChIKey is LSKXKKRXPZWVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-12-10-9-7-13-6-8(9)2-3-11(10)4-5-11/h6-7,10,12H,2-5H2,1H3.
What are the key properties of N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine?
N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine has a molecular weight of 177.25 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylspiro[6,7-dihydro-4H-2-benzofuran-5,1'-cyclopropane]-4-amine is sourced from PubChem (CID 112714495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).