About spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one
spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one (PubChem CID 112714834) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one.
Analyze spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
The IUPAC name of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one (CID 112714834) is spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one.
What is the SMILES notation for spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
The canonical SMILES for spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one is O=C1c2ccncc2CCC12CCC2.
What is the InChIKey of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
The InChIKey is YOXXLDDJOFQQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c14-11-10-3-7-13-8-9(10)2-6-12(11)4-1-5-12/h3,7-8H,1-2,4-6H2.
What are the key properties of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one has a molecular weight of 187.24 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one is sourced from PubChem (CID 112714834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).