About spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one
spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one (PubChem CID 112714834) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one.
Molecular Properties
| Compound Name | spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one |
| PubChem CID | 112714834 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one |
| SMILES | O=C1c2ccncc2CCC12CCC2 |
| InChI | InChI=1S/C12H13NO/c14-11-10-3-7-13-8-9(10)2-6-12(11)4-1-5-12/h3,7-8H,1-2,4-6H2 |
| InChIKey | YOXXLDDJOFQQBM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
The IUPAC name of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one (CID 112714834) is spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one.
What is the SMILES notation for spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
The canonical SMILES for spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one is O=C1c2ccncc2CCC12CCC2.
What is the InChIKey of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
The InChIKey is YOXXLDDJOFQQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c14-11-10-3-7-13-8-9(10)2-6-12(11)4-1-5-12/h3,7-8H,1-2,4-6H2.
What are the key properties of spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one?
spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one has a molecular weight of 187.24 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[7,8-dihydroisoquinoline-6,1'-cyclobutane]-5-one is sourced from PubChem (CID 112714834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).