C19H20ClF5N6O — CID 11271555
5-chloro-6-[3-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11271555) has the molecular formula C19H20ClF5N6O and a molecular weight of 478.85 g/mol. Its IUPAC name is 5-chloro-6-[3-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[3-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11271555 |
| Molecular Formula | C19H20ClF5N6O |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 5-chloro-6-[3-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)ccc(OCCCN(C)C)c2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C19H20ClF5N6O/c1-10(19(23,24)25)28-17-14(16(20)29-18-26-9-27-31(17)18)13-11(21)5-6-12(15(13)22)32-8-4-7-30(2)3/h5-6,9-10,28H,4,7-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | GXPIFHVEFPCZPS-JTQLQIEISA-N |
| XLogP | 4.42 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|