About 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid
5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid (PubChem CID 112715998) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid.
Molecular Properties
| Compound Name | 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid |
| PubChem CID | 112715998 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid |
| SMILES | CC1CCc2cnccc2C1(O)C(=O)O |
| InChI | InChI=1S/C11H13NO3/c1-7-2-3-8-6-12-5-4-9(8)11(7,15)10(13)14/h4-7,15H,2-3H2,1H3,(H,13,14) |
| InChIKey | HJXRZXRBBANCOE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid?
The IUPAC name of 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid (CID 112715998) is 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid.
What is the SMILES notation for 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid?
The canonical SMILES for 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid is CC1CCc2cnccc2C1(O)C(=O)O.
What is the InChIKey of 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid?
The InChIKey is HJXRZXRBBANCOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-7-2-3-8-6-12-5-4-9(8)11(7,15)10(13)14/h4-7,15H,2-3H2,1H3,(H,13,14).
What are the key properties of 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid?
5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6-methyl-7,8-dihydro-6H-isoquinoline-5-carboxylic acid is sourced from PubChem (CID 112715998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).