About N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine
N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine (PubChem CID 112716170) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine |
| PubChem CID | 112716170 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine |
| SMILES | Cc1cc2c(s1)C(NC1CC1)C(C)C2 |
| InChI | InChI=1S/C12H17NS/c1-7-5-9-6-8(2)14-12(9)11(7)13-10-3-4-10/h6-7,10-11,13H,3-5H2,1-2H3 |
| InChIKey | SLFXDQRVFHSMJH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine?
The IUPAC name of N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine (CID 112716170) is N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine.
What is the SMILES notation for N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine?
The canonical SMILES for N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine is Cc1cc2c(s1)C(NC1CC1)C(C)C2.
What is the InChIKey of N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine?
The InChIKey is SLFXDQRVFHSMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-7-5-9-6-8(2)14-12(9)11(7)13-10-3-4-10/h6-7,10-11,13H,3-5H2,1-2H3.
What are the key properties of N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine?
N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine has a molecular weight of 207.34 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-6-amine is sourced from PubChem (CID 112716170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).