C11H19N3O — CID 112716355
4-(aminomethyl)-1,5,5-trimethyl-6,7-dihydroindazol-4-ol (PubChem CID 112716355) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(aminomethyl)-1,5,5-trimethyl-6,7-dihydroindazol-4-ol.
| Compound Name | 4-(aminomethyl)-1,5,5-trimethyl-6,7-dihydroindazol-4-ol |
|---|---|
| PubChem CID | 112716355 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-(aminomethyl)-1,5,5-trimethyl-6,7-dihydroindazol-4-ol |
| SMILES | Cn1ncc2c1CCC(C)(C)C2(O)CN |
| InChI | InChI=1S/C11H19N3O/c1-10(2)5-4-9-8(6-13-14(9)3)11(10,15)7-12/h6,15H,4-5,7,12H2,1-3H3 |
| InChIKey | LBFFTYOULFAERK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |