About 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole
5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole (PubChem CID 112716700) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole.
Molecular Properties
| Compound Name | 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole |
| PubChem CID | 112716700 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole |
| SMILES | Cc1cn2c(N=C=O)cnc2o1 |
| InChI | InChI=1S/C7H5N3O2/c1-5-3-10-6(9-4-11)2-8-7(10)12-5/h2-3H,1H3 |
| InChIKey | JOUHAUQPPYGQFX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole?
The IUPAC name of 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole (CID 112716700) is 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole.
What is the SMILES notation for 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole?
The canonical SMILES for 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole is Cc1cn2c(N=C=O)cnc2o1.
What is the InChIKey of 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole?
The InChIKey is JOUHAUQPPYGQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c1-5-3-10-6(9-4-11)2-8-7(10)12-5/h2-3H,1H3.
What are the key properties of 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole?
5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole has a molecular weight of 163.14 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-2-methylimidazo[2,1-b][1,3]oxazole is sourced from PubChem (CID 112716700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).