About 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol
3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol (PubChem CID 112716720) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol.
Molecular Properties
| Compound Name | 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol |
| PubChem CID | 112716720 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol |
| SMILES | CCC1c2c(O)cccc2NC1C |
| InChI | InChI=1S/C11H15NO/c1-3-8-7(2)12-9-5-4-6-10(13)11(8)9/h4-8,12-13H,3H2,1-2H3 |
| InChIKey | ACSJVMPXJLCDTH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol?
The IUPAC name of 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol (CID 112716720) is 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol.
What is the SMILES notation for 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol?
The canonical SMILES for 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol is CCC1c2c(O)cccc2NC1C.
What is the InChIKey of 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol?
The InChIKey is ACSJVMPXJLCDTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-3-8-7(2)12-9-5-4-6-10(13)11(8)9/h4-8,12-13H,3H2,1-2H3.
What are the key properties of 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol?
3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol has a molecular weight of 177.25 g/mol, XLogP of 2.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methyl-2,3-dihydro-1H-indol-4-ol is sourced from PubChem (CID 112716720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).