C10H11N3O2 — CID 112716837
4-[(2-methoxyphenyl)methyl]-1,2,5-oxadiazol-3-amine (PubChem CID 112716837) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methyl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[(2-methoxyphenyl)methyl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 112716837 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-[(2-methoxyphenyl)methyl]-1,2,5-oxadiazol-3-amine |
| SMILES | COc1ccccc1Cc1nonc1N |
| InChI | InChI=1S/C10H11N3O2/c1-14-9-5-3-2-4-7(9)6-8-10(11)13-15-12-8/h2-5H,6H2,1H3,(H2,11,13) |
| InChIKey | XNWQJDSUVMUGCB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |