C12H17NO2 — CID 112716867
1,2,3,4,4a,5,6,9b-octahydrofuro[2,3-h]quinolin-4-ylmethanol (PubChem CID 112716867) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,9b-octahydrofuro[2,3-h]quinolin-4-ylmethanol.
| Compound Name | 1,2,3,4,4a,5,6,9b-octahydrofuro[2,3-h]quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 112716867 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,9b-octahydrofuro[2,3-h]quinolin-4-ylmethanol |
| SMILES | OCC1CCNC2c3ccoc3CCC12 |
| InChI | InChI=1S/C12H17NO2/c14-7-8-3-5-13-12-9(8)1-2-11-10(12)4-6-15-11/h4,6,8-9,12-14H,1-3,5,7H2 |
| InChIKey | ZREDHOKOLMGKDJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |