About 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid
6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid (PubChem CID 112716984) has the molecular formula C8H11N3O2S
and a molecular weight of 213.26 g/mol. Its IUPAC name is 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid |
| PubChem CID | 112716984 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2ncns2)NC1 |
| InChI | InChI=1S/C8H11N3O2S/c12-8(13)5-1-2-6(9-3-5)7-10-4-11-14-7/h4-6,9H,1-3H2,(H,12,13) |
| InChIKey | OFDOVAHYFFGYEZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
The IUPAC name of 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid (CID 112716984) is 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid.
What is the SMILES notation for 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
The canonical SMILES for 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid is O=C(O)C1CCC(c2ncns2)NC1.
What is the InChIKey of 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
The InChIKey is OFDOVAHYFFGYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2S/c12-8(13)5-1-2-6(9-3-5)7-10-4-11-14-7/h4-6,9H,1-3H2,(H,12,13).
What are the key properties of 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid has a molecular weight of 213.26 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid is sourced from PubChem (CID 112716984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).