C30H39N3OS — CID 11271789
2-[(3S)-1-[3-[5-[3-(ethylamino)propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 11271789) has the molecular formula C30H39N3OS and a molecular weight of 489.73 g/mol. Its IUPAC name is 2-[(3S)-1-[3-[5-[3-(ethylamino)propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[3-[5-[3-(ethylamino)propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 11271789 |
| Molecular Formula | C30H39N3OS |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | 2-[(3S)-1-[3-[5-[3-(ethylamino)propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | CCNCCCc1ccc(CCCN2CC[C@@H](C(C(N)=O)(c3ccccc3)c3ccccc3)C2)s1 |
| InChI | InChI=1S/C30H39N3OS/c1-2-32-20-9-15-27-17-18-28(35-27)16-10-21-33-22-19-26(23-33)30(29(31)34,24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-8,11-14,17-18,26,32H,2,9-10,15-16,19-23H2,1H3,(H2,31,34)/t26-/m1/s1 |
| InChIKey | RRQDPSJPRDNUOW-AREMUKBSSA-N |
| XLogP | 5.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|