C12H15NO2 — CID 112718089
2-[2-(4-aminophenyl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 112718089) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[2-(4-aminophenyl)ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 112718089 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-[2-(4-aminophenyl)ethyl]cyclopropane-1-carboxylic acid |
| SMILES | Nc1ccc(CCC2CC2C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO2/c13-10-5-2-8(3-6-10)1-4-9-7-11(9)12(14)15/h2-3,5-6,9,11H,1,4,7,13H2,(H,14,15) |
| InChIKey | LLZDAIQWBNLSBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|