C36H32N2 — CID 11271849
(1R,2R)-N,N'-bis(naphthalen-1-ylmethyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 11271849) has the molecular formula C36H32N2 and a molecular weight of 492.67 g/mol. Its IUPAC name is (1R,2R)-N,N'-bis(naphthalen-1-ylmethyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1R,2R)-N,N'-bis(naphthalen-1-ylmethyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 11271849 |
| Molecular Formula | C36H32N2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (1R,2R)-N,N'-bis(naphthalen-1-ylmethyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | c1ccc([C@@H](NCc2cccc3ccccc23)[C@H](NCc2cccc3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H32N2/c1-3-15-29(16-4-1)35(37-25-31-21-11-19-27-13-7-9-23-33(27)31)36(30-17-5-2-6-18-30)38-26-32-22-12-20-28-14-8-10-24-34(28)32/h1-24,35-38H,25-26H2/t35-,36-/m1/s1 |
| InChIKey | XANGKRYJCUWBHS-LQFQNGICSA-N |
| XLogP | 8.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |