C19H29N3 — CID 112719294
4-[2-(3-tert-butyl-4-methylphenyl)butyl]-1-ethyltriazole (PubChem CID 112719294) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-[2-(3-tert-butyl-4-methylphenyl)butyl]-1-ethyltriazole.
| Compound Name | 4-[2-(3-tert-butyl-4-methylphenyl)butyl]-1-ethyltriazole |
|---|---|
| PubChem CID | 112719294 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 4-[2-(3-tert-butyl-4-methylphenyl)butyl]-1-ethyltriazole |
| SMILES | CCC(Cc1cn(CC)nn1)c1ccc(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H29N3/c1-7-15(11-17-13-22(8-2)21-20-17)16-10-9-14(3)18(12-16)19(4,5)6/h9-10,12-13,15H,7-8,11H2,1-6H3 |
| InChIKey | OVSXYWNWRGGRGJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |