C17H18N2O6 — CID 112719794
2-methoxycarbonyl-5-(2-methoxy-2-oxoethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 112719794) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-methoxycarbonyl-5-(2-methoxy-2-oxoethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-methoxycarbonyl-5-(2-methoxy-2-oxoethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 112719794 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-methoxycarbonyl-5-(2-methoxy-2-oxoethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | COC(=O)Cn1c2c(c3cc(C(=O)O)ccc31)CN(C(=O)OC)CC2 |
| InChI | InChI=1S/C17H18N2O6/c1-24-15(20)9-19-13-4-3-10(16(21)22)7-11(13)12-8-18(17(23)25-2)6-5-14(12)19/h3-4,7H,5-6,8-9H2,1-2H3,(H,21,22) |
| InChIKey | GKHZNHFDZSYAKV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|