C22H38O2Si — CID 11272035
(3E,5E,7E,9E,11S)-11-[tert-butyl(dimethyl)silyl]oxyhexadeca-3,5,7,9-tetraen-2-one (PubChem CID 11272035) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (3E,5E,7E,9E,11S)-11-[tert-butyl(dimethyl)silyl]oxyhexadeca-3,5,7,9-tetraen-2-one.
| Compound Name | (3E,5E,7E,9E,11S)-11-[tert-butyl(dimethyl)silyl]oxyhexadeca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 11272035 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (3E,5E,7E,9E,11S)-11-[tert-butyl(dimethyl)silyl]oxyhexadeca-3,5,7,9-tetraen-2-one |
| SMILES | CCCCC[C@@H](/C=C/C=C/C=C/C=C/C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-8-9-14-18-21(24-25(6,7)22(3,4)5)19-16-13-11-10-12-15-17-20(2)23/h10-13,15-17,19,21H,8-9,14,18H2,1-7H3/b12-10+,13-11+,17-15+,19-16+/t21-/m0/s1 |
| InChIKey | ATGUWMKTXKQVNT-VTPNVDFNSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|