C12H14F3NO5 — CID 112720910
1-(2,4-diethoxy-5-nitrophenyl)-2,2,2-trifluoroethanol (PubChem CID 112720910) has the molecular formula C12H14F3NO5 and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-(2,4-diethoxy-5-nitrophenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(2,4-diethoxy-5-nitrophenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 112720910 |
| Molecular Formula | C12H14F3NO5 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-(2,4-diethoxy-5-nitrophenyl)-2,2,2-trifluoroethanol |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1C(O)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO5/c1-3-20-9-6-10(21-4-2)8(16(18)19)5-7(9)11(17)12(13,14)15/h5-6,11,17H,3-4H2,1-2H3 |
| InChIKey | KDSVCKWKTHMSFY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|