C14H18F3NO5 — CID 112720923
2,2,2-trifluoro-1-(5-nitro-2,4-dipropoxyphenyl)ethanol (PubChem CID 112720923) has the molecular formula C14H18F3NO5 and a molecular weight of 337.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(5-nitro-2,4-dipropoxyphenyl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(5-nitro-2,4-dipropoxyphenyl)ethanol |
|---|---|
| PubChem CID | 112720923 |
| Molecular Formula | C14H18F3NO5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2,2,2-trifluoro-1-(5-nitro-2,4-dipropoxyphenyl)ethanol |
| SMILES | CCCOc1cc(OCCC)c([N+](=O)[O-])cc1C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO5/c1-3-5-22-11-8-12(23-6-4-2)10(18(20)21)7-9(11)13(19)14(15,16)17/h7-8,13,19H,3-6H2,1-2H3 |
| InChIKey | NRVVOBLOIXRXFT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|