C14H20F3N3 — CID 112722012
4-(4-ethylpiperazin-1-yl)-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 112722012) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 112722012 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CCN1CCN(c2ccc(NCC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H20F3N3/c1-2-19-7-9-20(10-8-19)13-5-3-12(4-6-13)18-11-14(15,16)17/h3-6,18H,2,7-11H2,1H3 |
| InChIKey | KSJKETJGTNJLCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|