C28H54O4Si2 — CID 11272203
(2Z,4aS,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(hydroxymethylidene)-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-one (PubChem CID 11272203) has the molecular formula C28H54O4Si2 and a molecular weight of 510.91 g/mol. Its IUPAC name is (2Z,4aS,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(hydroxymethylidene)-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-one.
| Compound Name | (2Z,4aS,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(hydroxymethylidene)-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 11272203 |
| Molecular Formula | C28H54O4Si2 |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | (2Z,4aS,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(hydroxymethylidene)-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC[C@]2(C)C(=O)/C(=C\O)CC[C@H]2[C@]1(C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O4Si2/c1-11-34(12-2,13-3)32-24-17-19-28(8)23(16-15-22(21-29)25(28)30)27(24,7)18-14-20-31-33(9,10)26(4,5)6/h21,23-24,29H,11-20H2,1-10H3/b22-21-/t23-,24+,27-,28-/m0/s1 |
| InChIKey | AQRLTAYWJHVIQU-LWTQCCIXSA-N |
| XLogP | 8.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|