C19H39N3O2 — CID 112722279
tert-butyl N-butyl-N-[2-[3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 112722279) has the molecular formula C19H39N3O2 and a molecular weight of 341.54 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[2-[3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[2-[3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 112722279 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | tert-butyl N-butyl-N-[2-[3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CCCCN(CCN1CCC(CNC(C)C)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39N3O2/c1-7-8-10-22(18(23)24-19(4,5)6)13-12-21-11-9-17(15-21)14-20-16(2)3/h16-17,20H,7-15H2,1-6H3 |
| InChIKey | LVAXRVRFHHDSRE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |