C29H26N2 — CID 11272308
(4R,5S)-2-(2,2-diphenylethyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole (PubChem CID 11272308) has the molecular formula C29H26N2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (4R,5S)-2-(2,2-diphenylethyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2-(2,2-diphenylethyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11272308 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (4R,5S)-2-(2,2-diphenylethyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(C(CC2=N[C@H](c3ccccc3)[C@H](c3ccccc3)N2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27-30-28(24-17-9-3-10-18-24)29(31-27)25-19-11-4-12-20-25/h1-20,26,28-29H,21H2,(H,30,31)/t28-,29+ |
| InChIKey | XHAIXIPFFWBCDE-ISILISOKSA-N |
| XLogP | 6.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |