C34H32N2O3 — CID 11272317
3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(pyridin-2-ylmethyl)indole-6-carboxylic acid (PubChem CID 11272317) has the molecular formula C34H32N2O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(pyridin-2-ylmethyl)indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(pyridin-2-ylmethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 11272317 |
| Molecular Formula | C34H32N2O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 3-cyclohexyl-2-(4-phenylmethoxyphenyl)-1-(pyridin-2-ylmethyl)indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c(-c3ccc(OCc4ccccc4)cc3)n(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C34H32N2O3/c37-34(38)27-16-19-30-31(21-27)36(22-28-13-7-8-20-35-28)33(32(30)25-11-5-2-6-12-25)26-14-17-29(18-15-26)39-23-24-9-3-1-4-10-24/h1,3-4,7-10,13-21,25H,2,5-6,11-12,22-23H2,(H,37,38) |
| InChIKey | PVVUSDGZTDLBFL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |