C32H40O4Si — CID 11272321
(6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-one (PubChem CID 11272321) has the molecular formula C32H40O4Si and a molecular weight of 516.75 g/mol. Its IUPAC name is (6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-one.
| Compound Name | (6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-one |
|---|---|
| PubChem CID | 11272321 |
| Molecular Formula | C32H40O4Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | (6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-one |
| SMILES | CC(C)(C)[Si](O[C@@H](CCOCc1ccccc1)C[C@@H]1CCCC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40O4Si/c1-32(2,3)37(29-17-9-5-10-18-29,30-19-11-6-12-20-30)36-28(24-27-16-13-21-31(33)35-27)22-23-34-25-26-14-7-4-8-15-26/h4-12,14-15,17-20,27-28H,13,16,21-25H2,1-3H3/t27-,28-/m0/s1 |
| InChIKey | OEVJXULACNKOBZ-NSOVKSMOSA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|