C11H21NO3 — CID 112723780
propan-2-yl 3-(2,2-dimethylpropanoylamino)propanoate (PubChem CID 112723780) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is propan-2-yl 3-(2,2-dimethylpropanoylamino)propanoate.
| Compound Name | propan-2-yl 3-(2,2-dimethylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 112723780 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | propan-2-yl 3-(2,2-dimethylpropanoylamino)propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-8(2)15-9(13)6-7-12-10(14)11(3,4)5/h8H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | XNSLCLPNZRLEPD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |