C32H42O6 — CID 11272428
(1S,3R,5S,6R,8S,10R,12S,14S)-6-ethenyl-1,3-dimethyl-14-phenylmethoxy-12-(3-phenylmethoxypropyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol (PubChem CID 11272428) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is (1S,3R,5S,6R,8S,10R,12S,14S)-6-ethenyl-1,3-dimethyl-14-phenylmethoxy-12-(3-phenylmethoxypropyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol.
| Compound Name | (1S,3R,5S,6R,8S,10R,12S,14S)-6-ethenyl-1,3-dimethyl-14-phenylmethoxy-12-(3-phenylmethoxypropyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol |
|---|---|
| PubChem CID | 11272428 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (1S,3R,5S,6R,8S,10R,12S,14S)-6-ethenyl-1,3-dimethyl-14-phenylmethoxy-12-(3-phenylmethoxypropyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol |
| SMILES | C=C[C@H]1O[C@H]2C[C@H]3O[C@@H](CCCOCc4ccccc4)C[C@H](OCc4ccccc4)[C@]3(C)O[C@]2(C)C[C@@H]1O |
| InChI | InChI=1S/C32H42O6/c1-4-27-26(33)20-31(2)28(37-27)19-30-32(3,38-31)29(35-22-24-14-9-6-10-15-24)18-25(36-30)16-11-17-34-21-23-12-7-5-8-13-23/h4-10,12-15,25-30,33H,1,11,16-22H2,2-3H3/t25-,26-,27+,28-,29-,30+,31+,32-/m0/s1 |
| InChIKey | YRRSWMUALXRPFR-NFENYHTQSA-N |
| XLogP | 5.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|