C15H14F2O2S — CID 112725157
2-(3,4-difluorophenyl)sulfanyl-1-(3-methoxyphenyl)ethanol (PubChem CID 112725157) has the molecular formula C15H14F2O2S and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-1-(3-methoxyphenyl)ethanol.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-1-(3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 112725157 |
| Molecular Formula | C15H14F2O2S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-1-(3-methoxyphenyl)ethanol |
| SMILES | COc1cccc(C(O)CSc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H14F2O2S/c1-19-11-4-2-3-10(7-11)15(18)9-20-12-5-6-13(16)14(17)8-12/h2-8,15,18H,9H2,1H3 |
| InChIKey | NGLYVPUVSLNLJA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |