C29H43NO4SSi — CID 11272531
(4R)-4-[(E,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-methylundec-2-en-9-ynoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 11272531) has the molecular formula C29H43NO4SSi and a molecular weight of 529.82 g/mol. Its IUPAC name is (4R)-4-[(E,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-methylundec-2-en-9-ynoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[(E,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-methylundec-2-en-9-ynoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 11272531 |
| Molecular Formula | C29H43NO4SSi |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | (4R)-4-[(E,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-methylundec-2-en-9-ynoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | CC#C[C@@H](C)CC[C@H](C/C=C/C(=O)[C@@H]1CSC(=O)N1Cc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H43NO4SSi/c1-9-11-22(2)14-17-25(34-36(7,8)29(3,4)5)12-10-13-27(31)26-21-35-28(32)30(26)20-23-15-18-24(33-6)19-16-23/h10,13,15-16,18-19,22,25-26H,12,14,17,20-21H2,1-8H3/b13-10+/t22-,25+,26+/m1/s1 |
| InChIKey | HSHAZUIBVFZUNZ-DIPSSQFOSA-N |
| XLogP | 7.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|