C12H19N5O2 — CID 112726456
4-N-cyclohexyl-4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine (PubChem CID 112726456) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-N-cyclohexyl-4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclohexyl-4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112726456 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-N-cyclohexyl-4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(N(C)C2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N5O2/c1-13-11-10(17(18)19)12(15-8-14-11)16(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,13,14,15) |
| InChIKey | CZRGIPFVUGWROH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|