methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate

C8H10F3NO3 — CID 112727125

IUPACmethyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CC(=O)N(CC(F)(F)F)C1
InChIInChI=1S/C8H10F3NO3/c1-15-7(14)5-2-6(13)12(3-5)4-8(9,10)11/h5H,2-4H2,1H3
InChIKeyBYOADOLOOVEULR-UHFFFAOYSA-N
MW225.17 g/mol
LogP0.57
Rot. Bonds2

About methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate

methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate (PubChem CID 112727125) has the molecular formula C8H10F3NO3 and a molecular weight of 225.17 g/mol. Its IUPAC name is methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate
PubChem CID112727125
Molecular FormulaC8H10F3NO3
Molecular Weight225.17 g/mol
Exact Mass225.06
IUPAC Namemethyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CC(=O)N(CC(F)(F)F)C1
InChIInChI=1S/C8H10F3NO3/c1-15-7(14)5-2-6(13)12(3-5)4-8(9,10)11/h5H,2-4H2,1H3
InChIKeyBYOADOLOOVEULR-UHFFFAOYSA-N
XLogP0.57
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.17
LogP ≤ 50.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate (CID 112727125) is methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate is COC(=O)C1CC(=O)N(CC(F)(F)F)C1.
What is the InChIKey of methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate?
The InChIKey is BYOADOLOOVEULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO3/c1-15-7(14)5-2-6(13)12(3-5)4-8(9,10)11/h5H,2-4H2,1H3.
What are the key properties of methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate?
methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate has a molecular weight of 225.17 g/mol, XLogP of 0.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 112727125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).