C15H19ClN2O2 — CID 112728875
N-[1-(3-chlorophenyl)propyl]-6-oxopiperidine-3-carboxamide (PubChem CID 112728875) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)propyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[1-(3-chlorophenyl)propyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112728875 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-[1-(3-chlorophenyl)propyl]-6-oxopiperidine-3-carboxamide |
| SMILES | CCC(NC(=O)C1CCC(=O)NC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-2-13(10-4-3-5-12(16)8-10)18-15(20)11-6-7-14(19)17-9-11/h3-5,8,11,13H,2,6-7,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | PTAHDKVNCONSTN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |