About 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium
4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium (PubChem CID 11272910) has the molecular formula C28H29O6PS2
and a molecular weight of 556.64 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium |
| PubChem CID | 11272910 |
| Molecular Formula | C28H29O6PS2 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.O=S(=O)(O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21O3PS.C7H8O3S/c22-26(23,24)18-10-17-25(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,11-16H,10,17-18H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | AOKLGVCURZKCAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium?
The IUPAC name of 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium (CID 11272910) is 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium.
What is the SMILES notation for 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium?
The canonical SMILES for 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium is Cc1ccc(S(=O)(=O)[O-])cc1.O=S(=O)(O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium?
The InChIKey is AOKLGVCURZKCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21O3PS.C7H8O3S/c22-26(23,24)18-10-17-25(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,11-16H,10,17-18H2;2-5H,1H3,(H,8,9,10).
What are the key properties of 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium?
4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium has a molecular weight of 556.64 g/mol, XLogP of 4.16, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;triphenyl(3-sulfopropyl)phosphanium is sourced from PubChem (CID 11272910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).