C31H32N6O3S — CID 11273070
2-[2-(4-methoxy-2-pyridinyl)ethyl]-6-[4-[4-(4-methylphenyl)piperazin-1-yl]sulfonylphenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 11273070) has the molecular formula C31H32N6O3S and a molecular weight of 568.70 g/mol. Its IUPAC name is 2-[2-(4-methoxy-2-pyridinyl)ethyl]-6-[4-[4-(4-methylphenyl)piperazin-1-yl]sulfonylphenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[2-(4-methoxy-2-pyridinyl)ethyl]-6-[4-[4-(4-methylphenyl)piperazin-1-yl]sulfonylphenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 11273070 |
| Molecular Formula | C31H32N6O3S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 2-[2-(4-methoxy-2-pyridinyl)ethyl]-6-[4-[4-(4-methylphenyl)piperazin-1-yl]sulfonylphenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccnc(CCc2nc3ncc(-c4ccc(S(=O)(=O)N5CCN(c6ccc(C)cc6)CC5)cc4)cc3[nH]2)c1 |
| InChI | InChI=1S/C31H32N6O3S/c1-22-3-8-26(9-4-22)36-15-17-37(18-16-36)41(38,39)28-10-5-23(6-11-28)24-19-29-31(33-21-24)35-30(34-29)12-7-25-20-27(40-2)13-14-32-25/h3-6,8-11,13-14,19-21H,7,12,15-18H2,1-2H3,(H,33,34,35) |
| InChIKey | JJYUUKAFDVDYFK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|