C30H58O6Si2 — CID 11273103
(1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12-ethenyl-3,5-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol (PubChem CID 11273103) has the molecular formula C30H58O6Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is (1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12-ethenyl-3,5-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol.
| Compound Name | (1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12-ethenyl-3,5-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
|---|---|
| PubChem CID | 11273103 |
| Molecular Formula | C30H58O6Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | (1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12-ethenyl-3,5-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
| SMILES | C=C[C@H]1O[C@H]2C[C@H]3O[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@](C)(O[Si](C)(C)C(C)(C)C)C[C@]3(C)O[C@@H]2CC[C@@H]1O |
| InChI | InChI=1S/C30H58O6Si2/c1-14-22-21(31)15-16-23-24(33-22)19-26-29(8,35-23)20-30(9,36-38(12,13)28(5,6)7)25(34-26)17-18-32-37(10,11)27(2,3)4/h14,21-26,31H,1,15-20H2,2-13H3/t21-,22+,23+,24-,25-,26+,29-,30+/m0/s1 |
| InChIKey | IQXKHUGOJUIHMY-LGJJHMIVSA-N |
| XLogP | 6.98 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|