About N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine (PubChem CID 112731160) has the molecular formula C11H9Cl2FN2S
and a molecular weight of 291.18 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine |
| PubChem CID | 112731160 |
| Molecular Formula | C11H9Cl2FN2S |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine |
| SMILES | CC(Nc1nccs1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C11H9Cl2FN2S/c1-6(16-11-15-4-5-17-11)9-7(12)2-3-8(14)10(9)13/h2-6H,1H3,(H,15,16) |
| InChIKey | RYDNQSXEPWSWGW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine?
The IUPAC name of N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine (CID 112731160) is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine.
What is the SMILES notation for N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine?
The canonical SMILES for N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine is CC(Nc1nccs1)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine?
The InChIKey is RYDNQSXEPWSWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2FN2S/c1-6(16-11-15-4-5-17-11)9-7(12)2-3-8(14)10(9)13/h2-6H,1H3,(H,15,16).
What are the key properties of N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine?
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine has a molecular weight of 291.18 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 112731160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).