C11H9Cl2FN2S — CID 112731160
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine (PubChem CID 112731160) has the molecular formula C11H9Cl2FN2S and a molecular weight of 291.18 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 112731160 |
| Molecular Formula | C11H9Cl2FN2S |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1,3-thiazol-2-amine |
| SMILES | CC(Nc1nccs1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C11H9Cl2FN2S/c1-6(16-11-15-4-5-17-11)9-7(12)2-3-8(14)10(9)13/h2-6H,1H3,(H,15,16) |
| InChIKey | RYDNQSXEPWSWGW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|