C15H24N4O2 — CID 112731395
N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2,2-diethoxyethanamine (PubChem CID 112731395) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 112731395 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cnc2c(c1)c(C)nn2C)OCC |
| InChI | InChI=1S/C15H24N4O2/c1-5-20-14(21-6-2)10-16-8-12-7-13-11(3)18-19(4)15(13)17-9-12/h7,9,14,16H,5-6,8,10H2,1-4H3 |
| InChIKey | ZJMARSBYPWYQPS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|