C22H24N2 — CID 11273162
(1R,4S)-1,7,7-trimethyl-2-N,3-N-diphenylbicyclo[2.2.1]heptane-2,3-diimine (PubChem CID 11273162) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (1R,4S)-1,7,7-trimethyl-2-N,3-N-diphenylbicyclo[2.2.1]heptane-2,3-diimine.
| Compound Name | (1R,4S)-1,7,7-trimethyl-2-N,3-N-diphenylbicyclo[2.2.1]heptane-2,3-diimine |
|---|---|
| PubChem CID | 11273162 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (1R,4S)-1,7,7-trimethyl-2-N,3-N-diphenylbicyclo[2.2.1]heptane-2,3-diimine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=N/c1ccccc1)/C2=N/c1ccccc1 |
| InChI | InChI=1S/C22H24N2/c1-21(2)18-14-15-22(21,3)20(24-17-12-8-5-9-13-17)19(18)23-16-10-6-4-7-11-16/h4-13,18H,14-15H2,1-3H3/b23-19+,24-20+/t18-,22+/m1/s1 |
| InChIKey | XRLIHGLJJCNLGF-IFKFOUBDSA-N |
| XLogP | 5.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|