C12H16N4O3 — CID 112731690
1-(3-morpholin-4-ylpropyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 112731690) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 112731690 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(CCCN2CCOCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N4O3/c13-8-10-9-16(12(18)14-11(10)17)3-1-2-15-4-6-19-7-5-15/h9H,1-7H2,(H,14,17,18) |
| InChIKey | CXDKHPMORRUHSK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |