About (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol
(3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol (PubChem CID 112734197) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol |
| PubChem CID | 112734197 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol |
| SMILES | Cc1cc(C)n2cc(CN3CC[C@@H](O)C3)nc2n1 |
| InChI | InChI=1S/C13H18N4O/c1-9-5-10(2)17-7-11(15-13(17)14-9)6-16-4-3-12(18)8-16/h5,7,12,18H,3-4,6,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | JNWBSXGRSCFQEO-GFCCVEGCSA-N |
| XLogP | 0.91 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol?
The IUPAC name of (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol (CID 112734197) is (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol.
What is the SMILES notation for (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol?
The canonical SMILES for (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol is Cc1cc(C)n2cc(CN3CC[C@@H](O)C3)nc2n1.
What is the InChIKey of (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol?
The InChIKey is JNWBSXGRSCFQEO-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H18N4O/c1-9-5-10(2)17-7-11(15-13(17)14-9)6-16-4-3-12(18)8-16/h5,7,12,18H,3-4,6,8H2,1-2H3/t12-/m1/s1.
What are the key properties of (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol?
(3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol has a molecular weight of 246.31 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyrrolidin-3-ol is sourced from PubChem (CID 112734197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).