C12H19N3O4 — CID 112734917
(2S)-3-cyclopropyl-2-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid (PubChem CID 112734917) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-3-cyclopropyl-2-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-cyclopropyl-2-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 112734917 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S)-3-cyclopropyl-2-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid |
| SMILES | CN1CCN(C(=O)N[C@@H](CC2CC2)C(=O)O)CC1=O |
| InChI | InChI=1S/C12H19N3O4/c1-14-4-5-15(7-10(14)16)12(19)13-9(11(17)18)6-8-2-3-8/h8-9H,2-7H2,1H3,(H,13,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | SVRQUJVGXFCKOG-VIFPVBQESA-N |
| XLogP | -0.28 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |