C32H32F8N2O — CID 11273508
N-[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 11273508) has the molecular formula C32H32F8N2O and a molecular weight of 612.61 g/mol. Its IUPAC name is N-[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11273508 |
| Molecular Formula | C32H32F8N2O |
| Molecular Weight | 612.61 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | N-[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCN(CCCCCC(c2ccc(F)cc2)c2ccc(F)cc2)C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H32F8N2O/c33-27-9-5-22(6-10-27)29(23-7-11-28(34)12-8-23)4-2-1-3-14-42-15-13-21(20-42)19-41-30(43)24-16-25(31(35,36)37)18-26(17-24)32(38,39)40/h5-12,16-18,21,29H,1-4,13-15,19-20H2,(H,41,43) |
| InChIKey | RYLXNIBUJUTFDK-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.61 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|